C22H24O5 — CID 162402275
(3S,7R)-3-methoxy-7,8-bis(phenylmethoxy)-2-oxabicyclo[2.2.2]oct-5-en-4-ol (PubChem CID 162402275) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3S,7R)-3-methoxy-7,8-bis(phenylmethoxy)-2-oxabicyclo[2.2.2]oct-5-en-4-ol.
| Compound Name | (3S,7R)-3-methoxy-7,8-bis(phenylmethoxy)-2-oxabicyclo[2.2.2]oct-5-en-4-ol |
|---|---|
| PubChem CID | 162402275 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (3S,7R)-3-methoxy-7,8-bis(phenylmethoxy)-2-oxabicyclo[2.2.2]oct-5-en-4-ol |
| SMILES | CO[C@H]1OC2C=CC1(O)C(OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C22H24O5/c1-24-21-22(23)13-12-18(27-21)19(25-14-16-8-4-2-5-9-16)20(22)26-15-17-10-6-3-7-11-17/h2-13,18-21,23H,14-15H2,1H3/t18?,19-,20?,21+,22?/m1/s1 |
| InChIKey | ZYDHOPRBLOVHOO-VYFNKOTESA-N |
| XLogP | 2.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|