C28H29BrO7 — CID 10698043
methyl (2S,3S,4R,5R,6R)-3-bromo-2-hydroxy-4,5,6-tris(phenylmethoxy)oxane-2-carboxylate (PubChem CID 10698043) has the molecular formula C28H29BrO7 and a molecular weight of 557.44 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-3-bromo-2-hydroxy-4,5,6-tris(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-3-bromo-2-hydroxy-4,5,6-tris(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 10698043 |
| Molecular Formula | C28H29BrO7 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-3-bromo-2-hydroxy-4,5,6-tris(phenylmethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)O[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1Br |
| InChI | InChI=1S/C28H29BrO7/c1-32-27(30)28(31)25(29)23(33-17-20-11-5-2-6-12-20)24(34-18-21-13-7-3-8-14-21)26(36-28)35-19-22-15-9-4-10-16-22/h2-16,23-26,31H,17-19H2,1H3/t23-,24-,25+,26-,28-/m1/s1 |
| InChIKey | QKUAXCFLOGBLDU-JBMSBTKCSA-N |
| XLogP | 4.36 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|