C28H26O8 — CID 10791229
methyl (1S,3R,4R,5R,6S)-5-benzoyloxy-3,4-bis(phenylmethoxy)-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 10791229) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is methyl (1S,3R,4R,5R,6S)-5-benzoyloxy-3,4-bis(phenylmethoxy)-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5R,6S)-5-benzoyloxy-3,4-bis(phenylmethoxy)-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 10791229 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | methyl (1S,3R,4R,5R,6S)-5-benzoyloxy-3,4-bis(phenylmethoxy)-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]1O2 |
| InChI | InChI=1S/C28H26O8/c1-31-27(30)28-24(35-28)22(34-25(29)21-15-9-4-10-16-21)23(32-17-19-11-5-2-6-12-19)26(36-28)33-18-20-13-7-3-8-14-20/h2-16,22-24,26H,17-18H2,1H3/t22-,23-,24+,26-,28+/m1/s1 |
| InChIKey | CWHRGLUIILVIKE-QFMQXMQDSA-N |
| XLogP | 3.64 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|