C18H20O9 — CID 102063357
methyl (1S,3R,4R,5R,6S)-4,5-diacetyloxy-3-phenylmethoxy-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 102063357) has the molecular formula C18H20O9 and a molecular weight of 380.35 g/mol. Its IUPAC name is methyl (1S,3R,4R,5R,6S)-4,5-diacetyloxy-3-phenylmethoxy-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (1S,3R,4R,5R,6S)-4,5-diacetyloxy-3-phenylmethoxy-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 102063357 |
| Molecular Formula | C18H20O9 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | methyl (1S,3R,4R,5R,6S)-4,5-diacetyloxy-3-phenylmethoxy-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@@H](OCc3ccccc3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O2 |
| InChI | InChI=1S/C18H20O9/c1-10(19)24-13-14(25-11(2)20)16(23-9-12-7-5-4-6-8-12)27-18(15(13)26-18)17(21)22-3/h4-8,13-16H,9H2,1-3H3/t13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | TXOXWCVSIDODDA-QFXBJFAPSA-N |
| XLogP | 0.69 |
| TPSA | 109.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|