C32H40O6 — CID 134830931
(3S,6S)-3-butyl-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 134830931) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is (3S,6S)-3-butyl-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (3S,6S)-3-butyl-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 134830931 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (3S,6S)-3-butyl-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CCCC[C@]1(O)C(COCc2ccccc2)O[C@H](OC)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C32H40O6/c1-3-4-20-32(33)28(24-35-21-25-14-8-5-9-15-25)38-31(34-2)29(36-22-26-16-10-6-11-17-26)30(32)37-23-27-18-12-7-13-19-27/h5-19,28-31,33H,3-4,20-24H2,1-2H3/t28?,29?,30?,31-,32-/m0/s1 |
| InChIKey | RYFQJSKBDWRHNW-PFPYMUTBSA-N |
| XLogP | 5.67 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |