C25H34O6 — CID 46854914
(1R,3S,4S,6S)-2-pentyl-4,6-bis(phenylmethoxy)cyclohexane-1,2,3,5-tetrol (PubChem CID 46854914) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (1R,3S,4S,6S)-2-pentyl-4,6-bis(phenylmethoxy)cyclohexane-1,2,3,5-tetrol.
| Compound Name | (1R,3S,4S,6S)-2-pentyl-4,6-bis(phenylmethoxy)cyclohexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 46854914 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (1R,3S,4S,6S)-2-pentyl-4,6-bis(phenylmethoxy)cyclohexane-1,2,3,5-tetrol |
| SMILES | CCCCCC1(O)[C@H](O)[C@@H](OCc2ccccc2)C(O)[C@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C25H34O6/c1-2-3-10-15-25(29)23(27)21(30-16-18-11-6-4-7-12-18)20(26)22(24(25)28)31-17-19-13-8-5-9-14-19/h4-9,11-14,20-24,26-29H,2-3,10,15-17H2,1H3/t20?,21-,22-,23-,24+,25?/m0/s1 |
| InChIKey | NQBHYGYJODWJAA-CPEJVWAMSA-N |
| XLogP | 2.56 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|