C25H30O6 — CID 71818496
(5R,7S,8R,9R)-3-butyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol (PubChem CID 71818496) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (5R,7S,8R,9R)-3-butyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol.
| Compound Name | (5R,7S,8R,9R)-3-butyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
|---|---|
| PubChem CID | 71818496 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (5R,7S,8R,9R)-3-butyl-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
| SMILES | CCCCC12OC3[C@H](OCc4ccccc4)[C@H](O1)C(O)[C@H](O2)[C@H]3OCc1ccccc1 |
| InChI | InChI=1S/C25H30O6/c1-2-3-14-25-29-20-19(26)21(30-25)23(28-16-18-12-8-5-9-13-18)24(31-25)22(20)27-15-17-10-6-4-7-11-17/h4-13,19-24,26H,2-3,14-16H2,1H3/t19?,20-,21+,22-,23-,24?,25?/m1/s1 |
| InChIKey | LOPTUDBYTUSGAQ-WPFIQBIRSA-N |
| XLogP | 3.56 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |