C24H38O6Si — CID 102036233
(1R,5R,6R,7S,8S,9S)-3-butyl-8-[tert-butyl(dimethyl)silyl]oxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol (PubChem CID 102036233) has the molecular formula C24H38O6Si and a molecular weight of 450.65 g/mol. Its IUPAC name is (1R,5R,6R,7S,8S,9S)-3-butyl-8-[tert-butyl(dimethyl)silyl]oxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol.
| Compound Name | (1R,5R,6R,7S,8S,9S)-3-butyl-8-[tert-butyl(dimethyl)silyl]oxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
|---|---|
| PubChem CID | 102036233 |
| Molecular Formula | C24H38O6Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (1R,5R,6R,7S,8S,9S)-3-butyl-8-[tert-butyl(dimethyl)silyl]oxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-ol |
| SMILES | CCCCC12O[C@@H]3[C@@H](OCc4ccccc4)[C@H](O1)[C@@H](O)[C@H](O2)[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H38O6Si/c1-7-8-14-24-27-18-17(25)19(28-24)22(30-31(5,6)23(2,3)4)21(29-24)20(18)26-15-16-12-10-9-11-13-16/h9-13,17-22,25H,7-8,14-15H2,1-6H3/t17-,18-,19+,20+,21-,22+,24?/m1/s1 |
| InChIKey | OVJKTMHUAFJGHK-YRFHUNTPSA-N |
| XLogP | 4.36 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|