C21H21ClO3 — CID 102431638
(1R,2S,4R,5S)-3-chloro-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]oct-6-ene (PubChem CID 102431638) has the molecular formula C21H21ClO3 and a molecular weight of 356.85 g/mol. Its IUPAC name is (1R,2S,4R,5S)-3-chloro-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]oct-6-ene.
| Compound Name | (1R,2S,4R,5S)-3-chloro-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]oct-6-ene |
|---|---|
| PubChem CID | 102431638 |
| Molecular Formula | C21H21ClO3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (1R,2S,4R,5S)-3-chloro-2,4-bis(phenylmethoxy)-8-oxabicyclo[3.2.1]oct-6-ene |
| SMILES | ClC1[C@@H](OCc2ccccc2)[C@H]2C=C[C@H](O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H21ClO3/c22-19-20(23-13-15-7-3-1-4-8-15)17-11-12-18(25-17)21(19)24-14-16-9-5-2-6-10-16/h1-12,17-21H,13-14H2/t17-,18+,19?,20+,21- |
| InChIKey | AWACDKOTQNIBDC-JCCIXQHDSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|