C34H43NO6Si — CID 11421945
benzyl (2R,5R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-ethoxy-2-oxoethyl)-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 11421945) has the molecular formula C34H43NO6Si and a molecular weight of 589.81 g/mol. Its IUPAC name is benzyl (2R,5R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-ethoxy-2-oxoethyl)-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | benzyl (2R,5R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-ethoxy-2-oxoethyl)-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 11421945 |
| Molecular Formula | C34H43NO6Si |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | benzyl (2R,5R,6S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(2-ethoxy-2-oxoethyl)-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | CCOC(=O)C[C@@]1(O[Si](C)(C)C(C)(C)C)CN(C(=O)OCc2ccccc2)[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C34H43NO6Si/c1-7-38-29(36)23-34(41-42(5,6)33(2,3)4)25-35(32(37)39-24-26-17-11-8-12-18-26)30(27-19-13-9-14-20-27)31(40-34)28-21-15-10-16-22-28/h8-22,30-31H,7,23-25H2,1-6H3/t30-,31+,34-/m1/s1 |
| InChIKey | ZFAMVERDWNRNBF-JSWXEYCZSA-N |
| XLogP | 7.81 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|