C18H21F3N2O5 — CID 11774003
benzyl (2S,3aS,6aS)-2-(2-ethoxy-2-oxoethyl)-2-(trifluoromethyl)-3a,5,6,6a-tetrahydro-1H-pyrrolo[3,2-d][1,3]oxazole-4-carboxylate (PubChem CID 11774003) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is benzyl (2S,3aS,6aS)-2-(2-ethoxy-2-oxoethyl)-2-(trifluoromethyl)-3a,5,6,6a-tetrahydro-1H-pyrrolo[3,2-d][1,3]oxazole-4-carboxylate.
| Compound Name | benzyl (2S,3aS,6aS)-2-(2-ethoxy-2-oxoethyl)-2-(trifluoromethyl)-3a,5,6,6a-tetrahydro-1H-pyrrolo[3,2-d][1,3]oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11774003 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | benzyl (2S,3aS,6aS)-2-(2-ethoxy-2-oxoethyl)-2-(trifluoromethyl)-3a,5,6,6a-tetrahydro-1H-pyrrolo[3,2-d][1,3]oxazole-4-carboxylate |
| SMILES | CCOC(=O)C[C@]1(C(F)(F)F)N[C@H]2CCN(C(=O)OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C18H21F3N2O5/c1-2-26-14(24)10-17(18(19,20)21)22-13-8-9-23(15(13)28-17)16(25)27-11-12-6-4-3-5-7-12/h3-7,13,15,22H,2,8-11H2,1H3/t13-,15-,17-/m0/s1 |
| InChIKey | XIZFRLVSOJVOAM-QRTARXTBSA-N |
| XLogP | 2.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |