C30H35NO4Si — CID 11954744
benzyl (2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-diphenyl-2,3-dihydro-1,4-oxazine-4-carboxylate (PubChem CID 11954744) has the molecular formula C30H35NO4Si and a molecular weight of 501.70 g/mol. Its IUPAC name is benzyl (2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-diphenyl-2,3-dihydro-1,4-oxazine-4-carboxylate.
| Compound Name | benzyl (2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-diphenyl-2,3-dihydro-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 11954744 |
| Molecular Formula | C30H35NO4Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | benzyl (2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-diphenyl-2,3-dihydro-1,4-oxazine-4-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CN(C(=O)OCc2ccccc2)[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C30H35NO4Si/c1-30(2,3)36(4,5)35-26-21-31(29(32)33-22-23-15-9-6-10-16-23)27(24-17-11-7-12-18-24)28(34-26)25-19-13-8-14-20-25/h6-21,27-28H,22H2,1-5H3/t27-,28+/m1/s1 |
| InChIKey | DVAGRXGPDIUXDU-IZLXSDGUSA-N |
| XLogP | 7.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|