C36H41NO8 — CID 10875824
ditert-butyl 2-[[(3S,5S,6R)-2-oxo-5,6-diphenyl-4-phenylmethoxycarbonylmorpholin-3-yl]methyl]propanedioate (PubChem CID 10875824) has the molecular formula C36H41NO8 and a molecular weight of 615.72 g/mol. Its IUPAC name is ditert-butyl 2-[[(3S,5S,6R)-2-oxo-5,6-diphenyl-4-phenylmethoxycarbonylmorpholin-3-yl]methyl]propanedioate.
| Compound Name | ditert-butyl 2-[[(3S,5S,6R)-2-oxo-5,6-diphenyl-4-phenylmethoxycarbonylmorpholin-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 10875824 |
| Molecular Formula | C36H41NO8 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | ditert-butyl 2-[[(3S,5S,6R)-2-oxo-5,6-diphenyl-4-phenylmethoxycarbonylmorpholin-3-yl]methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C[C@H]1C(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H41NO8/c1-35(2,3)44-31(38)27(32(39)45-36(4,5)6)22-28-33(40)43-30(26-20-14-9-15-21-26)29(25-18-12-8-13-19-25)37(28)34(41)42-23-24-16-10-7-11-17-24/h7-21,27-30H,22-23H2,1-6H3/t28-,29-,30+/m0/s1 |
| InChIKey | LRSICIWBMHBZQE-OIFRRMEBSA-N |
| XLogP | 6.72 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|