C28H28INO4 — CID 11365118
benzyl (3S,5S,6R)-3-(4-iodobutyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 11365118) has the molecular formula C28H28INO4 and a molecular weight of 569.44 g/mol. Its IUPAC name is benzyl (3S,5S,6R)-3-(4-iodobutyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | benzyl (3S,5S,6R)-3-(4-iodobutyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 11365118 |
| Molecular Formula | C28H28INO4 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | benzyl (3S,5S,6R)-3-(4-iodobutyl)-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | O=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)N(C(=O)OCc2ccccc2)[C@H]1CCCCI |
| InChI | InChI=1S/C28H28INO4/c29-19-11-10-18-24-27(31)34-26(23-16-8-3-9-17-23)25(22-14-6-2-7-15-22)30(24)28(32)33-20-21-12-4-1-5-13-21/h1-9,12-17,24-26H,10-11,18-20H2/t24-,25-,26+/m0/s1 |
| InChIKey | FTIRNALLQMLEKT-KKUQBAQOSA-N |
| XLogP | 6.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|