C25H29NO4 — CID 10454077
tert-butyl (3S,5S,6R)-3-but-3-enyl-2-oxo-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 10454077) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl (3S,5S,6R)-3-but-3-enyl-2-oxo-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (3S,5S,6R)-3-but-3-enyl-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 10454077 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | tert-butyl (3S,5S,6R)-3-but-3-enyl-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | C=CCC[C@H]1C(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29NO4/c1-5-6-17-20-23(27)29-22(19-15-11-8-12-16-19)21(18-13-9-7-10-14-18)26(20)24(28)30-25(2,3)4/h5,7-16,20-22H,1,6,17H2,2-4H3/t20-,21-,22+/m0/s1 |
| InChIKey | XUZJKECLNPPVLC-FDFHNCONSA-N |
| XLogP | 5.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|