C32H44N2O6Si — CID 90791180
tert-butyl (3R,5R,6S)-2-oxo-5,6-diphenyl-3-[1-(2-trimethylsilylethoxycarbonyl)piperidin-4-yl]morpholine-4-carboxylate (PubChem CID 90791180) has the molecular formula C32H44N2O6Si and a molecular weight of 580.80 g/mol. Its IUPAC name is tert-butyl (3R,5R,6S)-2-oxo-5,6-diphenyl-3-[1-(2-trimethylsilylethoxycarbonyl)piperidin-4-yl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R,5R,6S)-2-oxo-5,6-diphenyl-3-[1-(2-trimethylsilylethoxycarbonyl)piperidin-4-yl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 90791180 |
| Molecular Formula | C32H44N2O6Si |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | tert-butyl (3R,5R,6S)-2-oxo-5,6-diphenyl-3-[1-(2-trimethylsilylethoxycarbonyl)piperidin-4-yl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](c2ccccc2)[C@H](c2ccccc2)OC(=O)[C@H]1C1CCN(C(=O)OCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C32H44N2O6Si/c1-32(2,3)40-31(37)34-26(23-13-9-7-10-14-23)28(25-15-11-8-12-16-25)39-29(35)27(34)24-17-19-33(20-18-24)30(36)38-21-22-41(4,5)6/h7-16,24,26-28H,17-22H2,1-6H3/t26-,27-,28+/m1/s1 |
| InChIKey | LETKMSIZHAZHQX-FCEKVYKBSA-N |
| XLogP | 6.82 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|