C40H48N2O5Si — CID 134884357
benzyl (5S,6R)-3-[(1S)-1-(benzylamino)-3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 134884357) has the molecular formula C40H48N2O5Si and a molecular weight of 664.92 g/mol. Its IUPAC name is benzyl (5S,6R)-3-[(1S)-1-(benzylamino)-3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | benzyl (5S,6R)-3-[(1S)-1-(benzylamino)-3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 134884357 |
| Molecular Formula | C40H48N2O5Si |
| Molecular Weight | 664.92 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | benzyl (5S,6R)-3-[(1S)-1-(benzylamino)-3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](NCc1ccccc1)C1C(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H48N2O5Si/c1-40(2,3)48(4,5)46-27-26-34(41-28-30-18-10-6-11-19-30)36-38(43)47-37(33-24-16-9-17-25-33)35(32-22-14-8-15-23-32)42(36)39(44)45-29-31-20-12-7-13-21-31/h6-25,34-37,41H,26-29H2,1-5H3/t34-,35-,36?,37+/m0/s1 |
| InChIKey | SZPUAEXPUGUUQN-YPYRDUQCSA-N |
| XLogP | 8.60 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.92 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|