C41H44N2O6Si — CID 11954746
benzyl (3R,5R,6S)-3-[(R)-(6-methoxyquinolin-4-yl)-triethylsilyloxymethyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate (PubChem CID 11954746) has the molecular formula C41H44N2O6Si and a molecular weight of 688.90 g/mol. Its IUPAC name is benzyl (3R,5R,6S)-3-[(R)-(6-methoxyquinolin-4-yl)-triethylsilyloxymethyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate.
| Compound Name | benzyl (3R,5R,6S)-3-[(R)-(6-methoxyquinolin-4-yl)-triethylsilyloxymethyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 11954746 |
| Molecular Formula | C41H44N2O6Si |
| Molecular Weight | 688.90 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | benzyl (3R,5R,6S)-3-[(R)-(6-methoxyquinolin-4-yl)-triethylsilyloxymethyl]-2-oxo-5,6-diphenylmorpholine-4-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](c1ccnc2ccc(OC)cc12)[C@@H]1C(=O)O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H44N2O6Si/c1-5-50(6-2,7-3)49-39(33-25-26-42-35-24-23-32(46-4)27-34(33)35)37-40(44)48-38(31-21-15-10-16-22-31)36(30-19-13-9-14-20-30)43(37)41(45)47-28-29-17-11-8-12-18-29/h8-27,36-39H,5-7,28H2,1-4H3/t36-,37-,38+,39-/m1/s1 |
| InChIKey | FESQLJXZUDOQJS-ZBMOXSJNSA-N |
| XLogP | 9.35 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.90 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|