C31H33N3O3 — CID 68565740
3-(dibenzylamino)-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-2-one (PubChem CID 68565740) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-(dibenzylamino)-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-2-one.
| Compound Name | 3-(dibenzylamino)-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 68565740 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 3-(dibenzylamino)-1-[2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-2-one |
| SMILES | COc1ccc2nccc(C(O)CN3CCCC(N(Cc4ccccc4)Cc4ccccc4)C3=O)c2c1 |
| InChI | InChI=1S/C31H33N3O3/c1-37-25-14-15-28-27(19-25)26(16-17-32-28)30(35)22-33-18-8-13-29(31(33)36)34(20-23-9-4-2-5-10-23)21-24-11-6-3-7-12-24/h2-7,9-12,14-17,19,29-30,35H,8,13,18,20-22H2,1H3 |
| InChIKey | GEGJOWLEPNTQFF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |