C28H31FN4O6 — CID 44535578
(1R)-2-[4-[(3-fluoro-1H-indol-2-yl)methylamino]piperidin-1-yl]-1-(6-methoxyquinolin-4-yl)ethanol;oxalic acid (PubChem CID 44535578) has the molecular formula C28H31FN4O6 and a molecular weight of 538.58 g/mol. Its IUPAC name is (1R)-2-[4-[(3-fluoro-1H-indol-2-yl)methylamino]piperidin-1-yl]-1-(6-methoxyquinolin-4-yl)ethanol;oxalic acid.
| Compound Name | (1R)-2-[4-[(3-fluoro-1H-indol-2-yl)methylamino]piperidin-1-yl]-1-(6-methoxyquinolin-4-yl)ethanol;oxalic acid |
|---|---|
| PubChem CID | 44535578 |
| Molecular Formula | C28H31FN4O6 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (1R)-2-[4-[(3-fluoro-1H-indol-2-yl)methylamino]piperidin-1-yl]-1-(6-methoxyquinolin-4-yl)ethanol;oxalic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCc4[nH]c5ccccc5c4F)CC3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H29FN4O2.C2H2O4/c1-33-18-6-7-22-21(14-18)19(8-11-28-22)25(32)16-31-12-9-17(10-13-31)29-15-24-26(27)20-4-2-3-5-23(20)30-24;3-1(4)2(5)6/h2-8,11,14,17,25,29-30,32H,9-10,12-13,15-16H2,1H3;(H,3,4)(H,5,6)/t25-;/m0./s1 |
| InChIKey | KZXLYAPJYSDSCH-UQIIZPHYSA-N |
| XLogP | 3.31 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|