C25H28N4O6 — CID 10184310
(1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[(6-nitro-1,3-benzodioxol-5-yl)methylamino]piperidin-1-yl]ethanol (PubChem CID 10184310) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[(6-nitro-1,3-benzodioxol-5-yl)methylamino]piperidin-1-yl]ethanol.
| Compound Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[(6-nitro-1,3-benzodioxol-5-yl)methylamino]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 10184310 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-[(6-nitro-1,3-benzodioxol-5-yl)methylamino]piperidin-1-yl]ethanol |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCc4cc5c(cc4[N+](=O)[O-])OCO5)CC3)c2c1 |
| InChI | InChI=1S/C25H28N4O6/c1-33-18-2-3-21-20(11-18)19(4-7-26-21)23(30)14-28-8-5-17(6-9-28)27-13-16-10-24-25(35-15-34-24)12-22(16)29(31)32/h2-4,7,10-12,17,23,27,30H,5-6,8-9,13-15H2,1H3/t23-/m0/s1 |
| InChIKey | AKVZCTPKTKXUFZ-QHCPKHFHSA-N |
| XLogP | 3.17 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|