C28H31N5O7 — CID 135929376
6-[[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3H-quinazolin-4-one;oxalic acid (PubChem CID 135929376) has the molecular formula C28H31N5O7 and a molecular weight of 549.58 g/mol. Its IUPAC name is 6-[[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3H-quinazolin-4-one;oxalic acid.
| Compound Name | 6-[[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3H-quinazolin-4-one;oxalic acid |
|---|---|
| PubChem CID | 135929376 |
| Molecular Formula | C28H31N5O7 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 6-[[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]methyl]-3H-quinazolin-4-one;oxalic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCc4ccc5nc[nH]c(=O)c5c4)CC3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H29N5O3.C2H2O4/c1-34-19-3-5-23-21(13-19)20(6-9-27-23)25(32)15-31-10-7-18(8-11-31)28-14-17-2-4-24-22(12-17)26(33)30-16-29-24;3-1(4)2(5)6/h2-6,9,12-13,16,18,25,28,32H,7-8,10-11,14-15H2,1H3,(H,29,30,33);(H,3,4)(H,5,6)/t25-;/m0./s1 |
| InChIKey | ZRHQMHOOJLTBCY-UQIIZPHYSA-N |
| XLogP | 1.92 |
| TPSA | 177.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|