C24H37N3O2 — CID 22255916
2-[(1-heptylpiperidin-4-yl)amino]-1-(6-methoxyquinolin-4-yl)ethanol (PubChem CID 22255916) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-[(1-heptylpiperidin-4-yl)amino]-1-(6-methoxyquinolin-4-yl)ethanol.
| Compound Name | 2-[(1-heptylpiperidin-4-yl)amino]-1-(6-methoxyquinolin-4-yl)ethanol |
|---|---|
| PubChem CID | 22255916 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 2-[(1-heptylpiperidin-4-yl)amino]-1-(6-methoxyquinolin-4-yl)ethanol |
| SMILES | CCCCCCCN1CCC(NCC(O)c2ccnc3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C24H37N3O2/c1-3-4-5-6-7-14-27-15-11-19(12-16-27)26-18-24(28)21-10-13-25-23-9-8-20(29-2)17-22(21)23/h8-10,13,17,19,24,26,28H,3-7,11-12,14-16,18H2,1-2H3 |
| InChIKey | HGFIWFRQDHWRLH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|