C25H36N2O4S — CID 70176948
(3R,4R)-1-(2-butylsulfanylethyl)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 70176948) has the molecular formula C25H36N2O4S and a molecular weight of 460.64 g/mol. Its IUPAC name is (3R,4R)-1-(2-butylsulfanylethyl)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-(2-butylsulfanylethyl)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176948 |
| Molecular Formula | C25H36N2O4S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (3R,4R)-1-(2-butylsulfanylethyl)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | CCCCSCCN1CC[C@@H](CC[C@H](O)c2ccnc3ccc(OC)cc23)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C25H36N2O4S/c1-3-4-14-32-15-13-27-12-10-18(22(17-27)25(29)30)5-8-24(28)20-9-11-26-23-7-6-19(31-2)16-21(20)23/h6-7,9,11,16,18,22,24,28H,3-5,8,10,12-15,17H2,1-2H3,(H,29,30)/t18-,22+,24+/m1/s1 |
| InChIKey | LHQCCQVGWBAMBH-OUOWLKGYSA-N |
| XLogP | 4.61 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|