C26H38N2O4S — CID 70173992
2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]acetic acid (PubChem CID 70173992) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70173992 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]acetic acid |
| SMILES | CCCSCCCN1CCC(CCC(O)c2ccnc3ccc(OC)cc23)[C@@H](CC(=O)O)C1 |
| InChI | InChI=1S/C26H38N2O4S/c1-3-14-33-15-4-12-28-13-10-19(20(18-28)16-26(30)31)5-8-25(29)22-9-11-27-24-7-6-21(32-2)17-23(22)24/h6-7,9,11,17,19-20,25,29H,3-5,8,10,12-16,18H2,1-2H3,(H,30,31)/t19?,20-,25?/m0/s1 |
| InChIKey | IDNYGOUCRGCGGJ-CMAULLTDSA-N |
| XLogP | 5.00 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|