C27H40N2O4S — CID 70176616
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 70176616) has the molecular formula C27H40N2O4S and a molecular weight of 488.69 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70176616 |
| Molecular Formula | C27H40N2O4S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-propylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | CCCSCCCN1CCC(CC[C@H](O)c2ccnc3ccc(OC)cc23)C(CCC(=O)O)C1 |
| InChI | InChI=1S/C27H40N2O4S/c1-3-16-34-17-4-14-29-15-12-20(21(19-29)6-10-27(31)32)5-9-26(30)23-11-13-28-25-8-7-22(33-2)18-24(23)25/h7-8,11,13,18,20-21,26,30H,3-6,9-10,12,14-17,19H2,1-2H3,(H,31,32)/t20?,21?,26-/m0/s1 |
| InChIKey | VTJZZQZKADLANC-NSOLWDIASA-N |
| XLogP | 5.39 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|