C28H40N2O4S — CID 142654667
3-[(3R,4R)-1-(3-cyclobutylsulfanylpropyl)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 142654667) has the molecular formula C28H40N2O4S and a molecular weight of 500.71 g/mol. Its IUPAC name is 3-[(3R,4R)-1-(3-cyclobutylsulfanylpropyl)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-1-(3-cyclobutylsulfanylpropyl)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 142654667 |
| Molecular Formula | C28H40N2O4S |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 3-[(3R,4R)-1-(3-cyclobutylsulfanylpropyl)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCSC4CCC4)C[C@@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H40N2O4S/c1-34-22-8-9-26-25(18-22)24(12-14-29-26)27(31)10-6-20-13-16-30(19-21(20)7-11-28(32)33)15-3-17-35-23-4-2-5-23/h8-9,12,14,18,20-21,23,27,31H,2-7,10-11,13,15-17,19H2,1H3,(H,32,33)/t20?,21-,27?/m0/s1 |
| InChIKey | QLIXNAQWOZNQRH-NOSKCJGJSA-N |
| XLogP | 5.54 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|