C30H43FN2O3S — CID 70177783
3-[(3S,4R)-1-(3-cyclohexylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70177783) has the molecular formula C30H43FN2O3S and a molecular weight of 530.75 g/mol. Its IUPAC name is 3-[(3S,4R)-1-(3-cyclohexylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-1-(3-cyclohexylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70177783 |
| Molecular Formula | C30H43FN2O3S |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 3-[(3S,4R)-1-(3-cyclohexylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSC4CCCCC4)C[C@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H43FN2O3S/c1-36-24-10-12-29-27(20-24)26(14-16-32-29)28(31)11-8-22-15-18-33(21-23(22)9-13-30(34)35)17-5-19-37-25-6-3-2-4-7-25/h10,12,14,16,20,22-23,25,28H,2-9,11,13,15,17-19,21H2,1H3,(H,34,35)/t22-,23-,28-/m1/s1 |
| InChIKey | ZRCUNLDCQDURAW-MVOZIGHISA-N |
| XLogP | 7.29 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|