C25H35FN2O3S — CID 70175442
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 70175442) has the molecular formula C25H35FN2O3S and a molecular weight of 462.63 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175442 |
| Molecular Formula | C25H35FN2O3S |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCSC)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C25H35FN2O3S/c1-31-20-6-8-24-22(16-20)21(10-12-27-24)23(26)7-4-18-11-14-28(13-3-15-32-2)17-19(18)5-9-25(29)30/h6,8,10,12,16,18-19,23H,3-5,7,9,11,13-15,17H2,1-2H3,(H,29,30)/t18?,19?,23-/m0/s1 |
| InChIKey | BUTAYMYSUNBHTE-XWEVFREBSA-N |
| XLogP | 5.59 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|