C29H38FN3O3S — CID 70174240
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1-methylpyrrol-3-yl)sulfanylpropyl]piperidin-3-yl]propanoic acid (PubChem CID 70174240) has the molecular formula C29H38FN3O3S and a molecular weight of 527.71 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1-methylpyrrol-3-yl)sulfanylpropyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1-methylpyrrol-3-yl)sulfanylpropyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70174240 |
| Molecular Formula | C29H38FN3O3S |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1-methylpyrrol-3-yl)sulfanylpropyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCSc4ccn(C)c4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H38FN3O3S/c1-32-15-12-24(20-32)37-17-3-14-33-16-11-21(22(19-33)5-9-29(34)35)4-7-27(30)25-10-13-31-28-8-6-23(36-2)18-26(25)28/h6,8,10,12-13,15,18,20-22,27H,3-5,7,9,11,14,16-17,19H2,1-2H3,(H,34,35)/t21?,22?,27-/m0/s1 |
| InChIKey | XCAJDDQHONMDCX-SRDVKXRDSA-N |
| XLogP | 6.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|