C30H35Cl2FN2O3S — CID 70175366
3-[(3S,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70175366) has the molecular formula C30H35Cl2FN2O3S and a molecular weight of 593.59 g/mol. Its IUPAC name is 3-[(3S,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175366 |
| Molecular Formula | C30H35Cl2FN2O3S |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 3-[(3S,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSc4c(Cl)cccc4Cl)C[C@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H35Cl2FN2O3S/c1-38-22-8-10-28-24(18-22)23(12-14-34-28)27(33)9-6-20-13-16-35(19-21(20)7-11-29(36)37)15-3-17-39-30-25(31)4-2-5-26(30)32/h2,4-5,8,10,12,14,18,20-21,27H,3,6-7,9,11,13,15-17,19H2,1H3,(H,36,37)/t20-,21-,27-/m1/s1 |
| InChIKey | ACRSYCSKSGGEKX-LGVUCKNBSA-N |
| XLogP | 8.33 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|