C29H34Cl2N2O4S — CID 70172699
2-[(3R,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70172699) has the molecular formula C29H34Cl2N2O4S and a molecular weight of 577.57 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70172699 |
| Molecular Formula | C29H34Cl2N2O4S |
| Molecular Weight | 577.57 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-[(3R,4R)-1-[3-(2,6-dichlorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCSc4c(Cl)cccc4Cl)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C29H34Cl2N2O4S/c1-37-21-7-8-26-23(17-21)22(10-12-32-26)27(34)9-6-19-11-14-33(18-20(19)16-28(35)36)13-3-15-38-29-24(30)4-2-5-25(29)31/h2,4-5,7-8,10,12,17,19-20,27,34H,3,6,9,11,13-16,18H2,1H3,(H,35,36)/t19?,20-,27?/m0/s1 |
| InChIKey | FFKJYSHQIFUNGK-UZAYYHTJSA-N |
| XLogP | 6.96 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|