C30H35N3O4S — CID 70175998
2-[(3R,4R)-1-[3-(3-cyanophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70175998) has the molecular formula C30H35N3O4S and a molecular weight of 533.69 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[3-(3-cyanophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-[3-(3-cyanophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175998 |
| Molecular Formula | C30H35N3O4S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 2-[(3R,4R)-1-[3-(3-cyanophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCSc4cccc(C#N)c4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C30H35N3O4S/c1-37-24-7-8-28-27(18-24)26(10-12-32-28)29(34)9-6-22-11-14-33(20-23(22)17-30(35)36)13-3-15-38-25-5-2-4-21(16-25)19-31/h2,4-5,7-8,10,12,16,18,22-23,29,34H,3,6,9,11,13-15,17,20H2,1H3,(H,35,36)/t22?,23-,29?/m0/s1 |
| InChIKey | NZQYRGOUILMGJO-RRVDFPNFSA-N |
| XLogP | 5.52 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|