C28H36N2O3S — CID 21346543
(1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylsulfanylpropyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol (PubChem CID 21346543) has the molecular formula C28H36N2O3S and a molecular weight of 480.67 g/mol. Its IUPAC name is (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylsulfanylpropyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol.
| Compound Name | (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylsulfanylpropyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 21346543 |
| Molecular Formula | C28H36N2O3S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylsulfanylpropyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
| SMILES | COc1ccc2nccc([C@H](O)CCC3CCN(CCCSc4ccccc4)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C28H36N2O3S/c1-33-23-9-10-27-26(18-23)25(12-14-29-27)28(32)11-8-21-13-16-30(19-22(21)20-31)15-5-17-34-24-6-3-2-4-7-24/h2-4,6-7,9-10,12,14,18,21-22,28,31-32H,5,8,11,13,15-17,19-20H2,1H3/t21?,22-,28-/m1/s1 |
| InChIKey | UIQCWLUTCWWTHR-TZFJXLEPSA-N |
| XLogP | 5.17 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|