C28H32N2O3 — CID 21346542
(1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylprop-2-ynyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol (PubChem CID 21346542) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylprop-2-ynyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol.
| Compound Name | (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylprop-2-ynyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 21346542 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (1R)-3-[(3R,4R)-3-(hydroxymethyl)-1-(3-phenylprop-2-ynyl)piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
| SMILES | COc1ccc2nccc([C@H](O)CCC3CCN(CC#Cc4ccccc4)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C28H32N2O3/c1-33-24-10-11-27-26(18-24)25(13-15-29-27)28(32)12-9-22-14-17-30(19-23(22)20-31)16-5-8-21-6-3-2-4-7-21/h2-4,6-7,10-11,13,15,18,22-23,28,31-32H,9,12,14,16-17,19-20H2,1H3/t22?,23-,28-/m1/s1 |
| InChIKey | TYSQBTWASWLDQO-OWDANKPHSA-N |
| XLogP | 4.04 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|