C29H34N2O4 — CID 69353698
3-[(3R,4R)-3-(hydroxymethyl)-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol (PubChem CID 69353698) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[(3R,4R)-3-(hydroxymethyl)-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol.
| Compound Name | 3-[(3R,4R)-3-(hydroxymethyl)-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 69353698 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[(3R,4R)-3-(hydroxymethyl)-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-4-yl]-1-(6-methoxyquinolin-4-yl)propan-1-ol |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CC#Cc4ccccc4OC)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C29H34N2O4/c1-34-24-10-11-27-26(18-24)25(13-15-30-27)28(33)12-9-21-14-17-31(19-23(21)20-32)16-5-7-22-6-3-4-8-29(22)35-2/h3-4,6,8,10-11,13,15,18,21,23,28,32-33H,9,12,14,16-17,19-20H2,1-2H3/t21?,23-,28?/m1/s1 |
| InChIKey | RNRARSUGMBJRDP-XCYFHQAXSA-N |
| XLogP | 4.05 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|