C31H36N2O5 — CID 70175886
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid (PubChem CID 70175886) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175886 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methoxyphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CC#Cc4ccccc4OC)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H36N2O5/c1-37-25-11-12-28-27(20-25)26(15-17-32-28)29(34)13-9-22-16-19-33(21-24(22)10-14-31(35)36)18-5-7-23-6-3-4-8-30(23)38-2/h3-4,6,8,11-12,15,17,20,22,24,29,34H,9-10,13-14,16,18-19,21H2,1-2H3,(H,35,36)/t22?,24?,29-/m0/s1 |
| InChIKey | ZQPCERLONQYGED-MFZPEFSESA-N |
| XLogP | 4.92 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|