C30H33ClN2O4 — CID 70172681
3-[1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70172681) has the molecular formula C30H33ClN2O4 and a molecular weight of 521.06 g/mol. Its IUPAC name is 3-[1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70172681 |
| Molecular Formula | C30H33ClN2O4 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 3-[1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CC#Cc4ccccc4Cl)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H33ClN2O4/c1-37-24-10-11-28-26(19-24)25(14-16-32-28)29(34)12-8-21-15-18-33(20-23(21)9-13-30(35)36)17-4-6-22-5-2-3-7-27(22)31/h2-3,5,7,10-11,14,16,19,21,23,29,34H,8-9,12-13,15,17-18,20H2,1H3,(H,35,36)/t21?,23?,29-/m0/s1 |
| InChIKey | JCXRZWUKPGSQTF-BJFQTCHOSA-N |
| XLogP | 5.57 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|