C30H33ClN2O3 — CID 70172758
3-[(3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70172758) has the molecular formula C30H33ClN2O3 and a molecular weight of 505.06 g/mol. Its IUPAC name is 3-[(3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70172758 |
| Molecular Formula | C30H33ClN2O3 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 3-[(3R,4R)-1-[3-(2-chlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CC#Cc4ccccc4Cl)C[C@@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H33ClN2O3/c1-36-26-12-13-29-27(20-26)23(15-17-32-29)8-4-7-22-16-19-33(21-25(22)11-14-30(34)35)18-5-9-24-6-2-3-10-28(24)31/h2-3,6,10,12-13,15,17,20,22,25H,4,7-8,11,14,16,18-19,21H2,1H3,(H,34,35)/t22-,25+/m1/s1 |
| InChIKey | RXRWIDCAVODAHS-RDGATRHJSA-N |
| XLogP | 6.07 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|