C28H32N4O3 — CID 22454732
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylprop-2-ynyl)piperidin-3-yl]propanoic acid (PubChem CID 22454732) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylprop-2-ynyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylprop-2-ynyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454732 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylprop-2-ynyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CC#Cc4cccnn4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H32N4O3/c1-35-25-10-11-27-26(19-25)22(13-16-29-27)6-2-5-21-14-18-32(20-23(21)9-12-28(33)34)17-4-8-24-7-3-15-30-31-24/h3,7,10-11,13,15-16,19,21,23H,2,5-6,9,12,14,17-18,20H2,1H3,(H,33,34) |
| InChIKey | LDXSOHGDNOEWNM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|