C31H36N2O3 — CID 70176234
3-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(4-methylphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid (PubChem CID 70176234) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 3-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(4-methylphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(4-methylphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70176234 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 3-[(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(4-methylphenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CC#Cc4ccc(C)cc4)C[C@@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H36N2O3/c1-23-8-10-24(11-9-23)5-4-19-33-20-17-25(27(22-33)12-15-31(34)35)6-3-7-26-16-18-32-30-14-13-28(36-2)21-29(26)30/h8-11,13-14,16,18,21,25,27H,3,6-7,12,15,17,19-20,22H2,1-2H3,(H,34,35)/t25-,27+/m1/s1 |
| InChIKey | IQFOTAARBFPIBP-VPUSJEBWSA-N |
| XLogP | 5.73 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|