C30H32Cl2N2O3 — CID 22455158
3-[1-[3-(3,4-dichlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 22455158) has the molecular formula C30H32Cl2N2O3 and a molecular weight of 539.50 g/mol. Its IUPAC name is 3-[1-[3-(3,4-dichlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[3-(3,4-dichlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22455158 |
| Molecular Formula | C30H32Cl2N2O3 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 3-[1-[3-(3,4-dichlorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CC#Cc4ccc(Cl)c(Cl)c4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H32Cl2N2O3/c1-37-25-9-11-29-26(19-25)23(13-15-33-29)6-2-5-22-14-17-34(20-24(22)8-12-30(35)36)16-3-4-21-7-10-27(31)28(32)18-21/h7,9-11,13,15,18-19,22,24H,2,5-6,8,12,14,16-17,20H2,1H3,(H,35,36) |
| InChIKey | LMOULLGHPBUNAS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|