C30H31Cl3N2O3 — CID 22453211
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trichlorophenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid (PubChem CID 22453211) has the molecular formula C30H31Cl3N2O3 and a molecular weight of 573.95 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trichlorophenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trichlorophenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22453211 |
| Molecular Formula | C30H31Cl3N2O3 |
| Molecular Weight | 573.95 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2,4,6-trichlorophenyl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CC#Cc4c(Cl)cc(Cl)cc4Cl)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H31Cl3N2O3/c1-38-24-8-9-29-26(18-24)21(11-13-34-29)5-2-4-20-12-15-35(19-22(20)7-10-30(36)37)14-3-6-25-27(32)16-23(31)17-28(25)33/h8-9,11,13,16-18,20,22H,2,4-5,7,10,12,14-15,19H2,1H3,(H,36,37) |
| InChIKey | YWOKKVKRFXFVTP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.95 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|