C28H31ClN2O3S — CID 22455782
3-[1-[3-(3-chlorothiophen-2-yl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 22455782) has the molecular formula C28H31ClN2O3S and a molecular weight of 511.09 g/mol. Its IUPAC name is 3-[1-[3-(3-chlorothiophen-2-yl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[3-(3-chlorothiophen-2-yl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22455782 |
| Molecular Formula | C28H31ClN2O3S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 3-[1-[3-(3-chlorothiophen-2-yl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CC#Cc4sccc4Cl)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H31ClN2O3S/c1-34-23-8-9-26-24(18-23)21(11-14-30-26)5-2-4-20-12-16-31(19-22(20)7-10-28(32)33)15-3-6-27-25(29)13-17-35-27/h8-9,11,13-14,17-18,20,22H,2,4-5,7,10,12,15-16,19H2,1H3,(H,32,33) |
| InChIKey | LYTBHZDIDFADNZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|