C27H31N3O3S — CID 22454726
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-5-yl)prop-2-ynyl]piperidin-3-yl]propanoic acid (PubChem CID 22454726) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-5-yl)prop-2-ynyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-5-yl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454726 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-5-yl)prop-2-ynyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CC#Cc4cncs4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C27H31N3O3S/c1-33-23-8-9-26-25(16-23)21(11-13-29-26)5-2-4-20-12-15-30(18-22(20)7-10-27(31)32)14-3-6-24-17-28-19-34-24/h8-9,11,13,16-17,19-20,22H,2,4-5,7,10,12,14-15,18H2,1H3,(H,31,32) |
| InChIKey | DPSFMURRZVEROM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|