C28H30F2N2O2 — CID 69354309
[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-fluorophenyl)prop-2-ynyl]piperidin-3-yl]methanol (PubChem CID 69354309) has the molecular formula C28H30F2N2O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-fluorophenyl)prop-2-ynyl]piperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-fluorophenyl)prop-2-ynyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 69354309 |
| Molecular Formula | C28H30F2N2O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-fluorophenyl)prop-2-ynyl]piperidin-3-yl]methanol |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CC#Cc4ccccc4F)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C28H30F2N2O2/c1-34-23-9-11-28-25(17-23)24(12-14-31-28)27(30)10-8-20-13-16-32(18-22(20)19-33)15-4-6-21-5-2-3-7-26(21)29/h2-3,5,7,9,11-12,14,17,20,22,27,33H,8,10,13,15-16,18-19H2,1H3/t20-,22-,27+/m1/s1 |
| InChIKey | OMEZBWQJPMUNSP-NTOOTBGVSA-N |
| XLogP | 5.16 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|