C26H29FN4O2 — CID 69355497
[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylprop-2-ynyl)piperidin-3-yl]methanol (PubChem CID 69355497) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is [(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylprop-2-ynyl)piperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylprop-2-ynyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 69355497 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylprop-2-ynyl)piperidin-3-yl]methanol |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CC#Cc4ncccn4)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C26H29FN4O2/c1-33-21-6-8-25-23(16-21)22(9-13-28-25)24(27)7-5-19-10-15-31(17-20(19)18-32)14-2-4-26-29-11-3-12-30-26/h3,6,8-9,11-13,16,19-20,24,32H,5,7,10,14-15,17-18H2,1H3/t19-,20-,24-/m1/s1 |
| InChIKey | QMJGPYDMHBOQPJ-YOSAUDMPSA-N |
| XLogP | 3.81 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|