C28H31FN2O2 — CID 69353999
[(3R,4R)-1-[3-(2-fluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol (PubChem CID 69353999) has the molecular formula C28H31FN2O2 and a molecular weight of 446.57 g/mol. Its IUPAC name is [(3R,4R)-1-[3-(2-fluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-[3-(2-fluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 69353999 |
| Molecular Formula | C28H31FN2O2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [(3R,4R)-1-[3-(2-fluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CC#Cc4ccccc4F)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C28H31FN2O2/c1-33-25-11-12-28-26(18-25)22(13-15-30-28)8-4-7-21-14-17-31(19-24(21)20-32)16-5-9-23-6-2-3-10-27(23)29/h2-3,6,10-13,15,18,21,24,32H,4,7-8,14,16-17,19-20H2,1H3/t21-,24-/m1/s1 |
| InChIKey | CBTHURFFMXCCFW-ZJSXRUAMSA-N |
| XLogP | 4.69 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|