C28H30F2N2O2 — CID 69354809
[(3R,4R)-1-[3-(2,6-difluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol (PubChem CID 69354809) has the molecular formula C28H30F2N2O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(3R,4R)-1-[3-(2,6-difluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol.
| Compound Name | [(3R,4R)-1-[3-(2,6-difluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 69354809 |
| Molecular Formula | C28H30F2N2O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [(3R,4R)-1-[3-(2,6-difluorophenyl)prop-2-ynyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]methanol |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CC#Cc4c(F)cccc4F)C[C@@H]3CO)c2c1 |
| InChI | InChI=1S/C28H30F2N2O2/c1-34-23-10-11-28-25(17-23)21(12-14-31-28)6-2-5-20-13-16-32(18-22(20)19-33)15-4-7-24-26(29)8-3-9-27(24)30/h3,8-12,14,17,20,22,33H,2,5-6,13,15-16,18-19H2,1H3/t20-,22-/m1/s1 |
| InChIKey | LGCQBGMAMVKMNI-IFMALSPDSA-N |
| XLogP | 4.83 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|