C29H31ClN2O4 — CID 70175259
2-[(3R,4R)-1-[3-(4-chlorophenyl)prop-2-ynyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70175259) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is 2-[(3R,4R)-1-[3-(4-chlorophenyl)prop-2-ynyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-[3-(4-chlorophenyl)prop-2-ynyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175259 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[(3R,4R)-1-[3-(4-chlorophenyl)prop-2-ynyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CC#Cc4ccc(Cl)cc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C29H31ClN2O4/c1-36-24-9-10-27-26(18-24)25(12-14-31-27)28(33)11-6-21-13-16-32(19-22(21)17-29(34)35)15-2-3-20-4-7-23(30)8-5-20/h4-5,7-10,12,14,18,21-22,28,33H,6,11,13,15-17,19H2,1H3,(H,34,35)/t21?,22-,28?/m0/s1 |
| InChIKey | REDBYQCSIHTRCM-QICJACQXSA-N |
| XLogP | 5.17 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|